C12H20F4N2O — CID 106293673
7,7-dimethyl-6-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 106293673) has the molecular formula C12H20F4N2O and a molecular weight of 284.30 g/mol. Its IUPAC name is 7,7-dimethyl-6-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | 7,7-dimethyl-6-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 106293673 |
| Molecular Formula | C12H20F4N2O |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 7,7-dimethyl-6-[(2,2,3,3-tetrafluoropropylamino)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CC1(C)C2OCCC2C1(N)CNCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H20F4N2O/c1-10(2)8-7(3-4-19-8)11(10,17)5-18-6-12(15,16)9(13)14/h7-9,18H,3-6,17H2,1-2H3 |
| InChIKey | YTFLBHFXZUCMKW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|