C11H15BrF4N4O — CID 106293708
4-bromo-2-[2-(dimethylamino)ethyl]-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one (PubChem CID 106293708) has the molecular formula C11H15BrF4N4O and a molecular weight of 375.16 g/mol. Its IUPAC name is 4-bromo-2-[2-(dimethylamino)ethyl]-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-[2-(dimethylamino)ethyl]-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 106293708 |
| Molecular Formula | C11H15BrF4N4O |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 4-bromo-2-[2-(dimethylamino)ethyl]-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one |
| SMILES | CN(C)CCn1ncc(NCC(F)(F)C(F)F)c(Br)c1=O |
| InChI | InChI=1S/C11H15BrF4N4O/c1-19(2)3-4-20-9(21)8(12)7(5-18-20)17-6-11(15,16)10(13)14/h5,10,17H,3-4,6H2,1-2H3 |
| InChIKey | ORHJBMIOAMWRRD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|