C9H14F4N2 — CID 106293760
N-[2-(azetidin-3-ylidene)propyl]-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 106293760) has the molecular formula C9H14F4N2 and a molecular weight of 226.22 g/mol. Its IUPAC name is N-[2-(azetidin-3-ylidene)propyl]-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-[2-(azetidin-3-ylidene)propyl]-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 106293760 |
| Molecular Formula | C9H14F4N2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-[2-(azetidin-3-ylidene)propyl]-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CC(CNCC(F)(F)C(F)F)=C1CNC1 |
| InChI | InChI=1S/C9H14F4N2/c1-6(7-3-14-4-7)2-15-5-9(12,13)8(10)11/h8,14-15H,2-5H2,1H3 |
| InChIKey | DCZBUTWEGRUSGE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|