C12H22F4N2O — CID 106293817
3-ethoxy-2,2-dimethyl-1-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclobutan-1-amine (PubChem CID 106293817) has the molecular formula C12H22F4N2O and a molecular weight of 286.31 g/mol. Its IUPAC name is 3-ethoxy-2,2-dimethyl-1-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclobutan-1-amine.
| Compound Name | 3-ethoxy-2,2-dimethyl-1-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 106293817 |
| Molecular Formula | C12H22F4N2O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3-ethoxy-2,2-dimethyl-1-[(2,2,3,3-tetrafluoropropylamino)methyl]cyclobutan-1-amine |
| SMILES | CCOC1CC(N)(CNCC(F)(F)C(F)F)C1(C)C |
| InChI | InChI=1S/C12H22F4N2O/c1-4-19-8-5-11(17,10(8,2)3)6-18-7-12(15,16)9(13)14/h8-9,18H,4-7,17H2,1-3H3 |
| InChIKey | CVEKZDKLSGKJTM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|