C9H9F4N5O — CID 106293846
5-methyl-7-(2,2,3,3-tetrafluoropropylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 106293846) has the molecular formula C9H9F4N5O and a molecular weight of 279.20 g/mol. Its IUPAC name is 5-methyl-7-(2,2,3,3-tetrafluoropropylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-methyl-7-(2,2,3,3-tetrafluoropropylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 106293846 |
| Molecular Formula | C9H9F4N5O |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 5-methyl-7-(2,2,3,3-tetrafluoropropylamino)-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1nc(NCC(F)(F)C(F)F)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C9H9F4N5O/c1-4-15-5(14-3-9(12,13)7(10)11)2-6-16-17-8(19)18(4)6/h2,7,14H,3H2,1H3,(H,17,19) |
| InChIKey | GZAQNBGGKDTWSF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|