C10H10ClF4N3O — CID 106293862
4-chloro-2-prop-2-enyl-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one (PubChem CID 106293862) has the molecular formula C10H10ClF4N3O and a molecular weight of 299.66 g/mol. Its IUPAC name is 4-chloro-2-prop-2-enyl-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one.
| Compound Name | 4-chloro-2-prop-2-enyl-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 106293862 |
| Molecular Formula | C10H10ClF4N3O |
| Molecular Weight | 299.66 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-chloro-2-prop-2-enyl-5-(2,2,3,3-tetrafluoropropylamino)pyridazin-3-one |
| SMILES | C=CCn1ncc(NCC(F)(F)C(F)F)c(Cl)c1=O |
| InChI | InChI=1S/C10H10ClF4N3O/c1-2-3-18-8(19)7(11)6(4-17-18)16-5-10(14,15)9(12)13/h2,4,9,16H,1,3,5H2 |
| InChIKey | YHGMRLFVYNDILK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.66 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|