C10H14F4N4 — CID 106294030
5,6-diethyl-N-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazin-3-amine (PubChem CID 106294030) has the molecular formula C10H14F4N4 and a molecular weight of 266.24 g/mol. Its IUPAC name is 5,6-diethyl-N-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 106294030 |
| Molecular Formula | C10H14F4N4 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 5,6-diethyl-N-(2,2,3,3-tetrafluoropropyl)-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NCC(F)(F)C(F)F)nc1CC |
| InChI | InChI=1S/C10H14F4N4/c1-3-6-7(4-2)17-18-9(16-6)15-5-10(13,14)8(11)12/h8H,3-5H2,1-2H3,(H,15,16,18) |
| InChIKey | GAUOYSOFSAFMPN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|