C14H19F4N3 — CID 106294106
2-cyclopentyl-1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 106294106) has the molecular formula C14H19F4N3 and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-cyclopentyl-1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 2-cyclopentyl-1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 106294106 |
| Molecular Formula | C14H19F4N3 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-cyclopentyl-1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | FC(F)C(F)(F)Cn1c(C2CCCC2)nc2c1CCNC2 |
| InChI | InChI=1S/C14H19F4N3/c15-13(16)14(17,18)8-21-11-5-6-19-7-10(11)20-12(21)9-3-1-2-4-9/h9,13,19H,1-8H2 |
| InChIKey | CEBGHRKGFSFQBT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|