C14H26F4N2 — CID 106294168
5-tert-butyl-2-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine (PubChem CID 106294168) has the molecular formula C14H26F4N2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-tert-butyl-2-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine.
| Compound Name | 5-tert-butyl-2-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine |
|---|---|
| PubChem CID | 106294168 |
| Molecular Formula | C14H26F4N2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 5-tert-butyl-2-propan-2-yl-1-(2,2,3,3-tetrafluoropropyl)piperazine |
| SMILES | CC(C)C1CNC(C(C)(C)C)CN1CC(F)(F)C(F)F |
| InChI | InChI=1S/C14H26F4N2/c1-9(2)10-6-19-11(13(3,4)5)7-20(10)8-14(17,18)12(15)16/h9-12,19H,6-8H2,1-5H3 |
| InChIKey | AYWDWENBRDLASN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|