C8H10F4N4 — CID 106294303
1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine (PubChem CID 106294303) has the molecular formula C8H10F4N4 and a molecular weight of 238.19 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine.
| Compound Name | 1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 106294303 |
| Molecular Formula | C8H10F4N4 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine |
| SMILES | FC(F)C(F)(F)Cn1nnc2c1CCNC2 |
| InChI | InChI=1S/C8H10F4N4/c9-7(10)8(11,12)4-16-6-1-2-13-3-5(6)14-15-16/h7,13H,1-4H2 |
| InChIKey | TXGBZAPREYAODV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|