2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid

C9H13F4NO2 — CID 106294349

IUPAC2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid
SMILESCCC(=CCNCC(F)(F)C(F)F)C(=O)O
InChIInChI=1S/C9H13F4NO2/c1-2-6(7(15)16)3-4-14-5-9(12,13)8(10)11/h3,8,14H,2,4-5H2,1H3,(H,15,16)
InChIKeyQCDBQFFIHUGIPR-UHFFFAOYSA-N
MW243.20 g/mol
LogP1.90
Rot. Bonds7

About 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid

2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid (PubChem CID 106294349) has the molecular formula C9H13F4NO2 and a molecular weight of 243.20 g/mol. Its IUPAC name is 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid.

Molecular Properties

Compound Name2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid
PubChem CID106294349
Molecular FormulaC9H13F4NO2
Molecular Weight243.20 g/mol
Exact Mass243.09
IUPAC Name2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid
SMILESCCC(=CCNCC(F)(F)C(F)F)C(=O)O
InChIInChI=1S/C9H13F4NO2/c1-2-6(7(15)16)3-4-14-5-9(12,13)8(10)11/h3,8,14H,2,4-5H2,1H3,(H,15,16)
InChIKeyQCDBQFFIHUGIPR-UHFFFAOYSA-N
XLogP1.90
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.20
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid?
The IUPAC name of 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid (CID 106294349) is 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid.
What is the SMILES notation for 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid?
The canonical SMILES for 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid is CCC(=CCNCC(F)(F)C(F)F)C(=O)O.
What is the InChIKey of 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid?
The InChIKey is QCDBQFFIHUGIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F4NO2/c1-2-6(7(15)16)3-4-14-5-9(12,13)8(10)11/h3,8,14H,2,4-5H2,1H3,(H,15,16).
What are the key properties of 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid?
2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid has a molecular weight of 243.20 g/mol, XLogP of 1.90, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoic acid is sourced from PubChem (CID 106294349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).