C10H15F4NO2 — CID 106294424
methyl 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoate (PubChem CID 106294424) has the molecular formula C10H15F4NO2 and a molecular weight of 257.23 g/mol. Its IUPAC name is methyl 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoate.
| Compound Name | methyl 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoate |
|---|---|
| PubChem CID | 106294424 |
| Molecular Formula | C10H15F4NO2 |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | methyl 2-ethyl-4-(2,2,3,3-tetrafluoropropylamino)but-2-enoate |
| SMILES | CCC(=CCNCC(F)(F)C(F)F)C(=O)OC |
| InChI | InChI=1S/C10H15F4NO2/c1-3-7(8(16)17-2)4-5-15-6-10(13,14)9(11)12/h4,9,15H,3,5-6H2,1-2H3 |
| InChIKey | MIESVKIWOIYJMV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|