C8H9F4N9 — CID 106294487
4-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine (PubChem CID 106294487) has the molecular formula C8H9F4N9 and a molecular weight of 307.22 g/mol. Its IUPAC name is 4-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106294487 |
| Molecular Formula | C8H9F4N9 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-hydrazinyl-N-(2,2,3,3-tetrafluoropropyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NCC(F)(F)C(F)F)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C8H9F4N9/c9-4(10)8(11,12)1-15-5-17-6(20-13)19-7(18-5)21-3-14-2-16-21/h2-4H,1,13H2,(H2,15,17,18,19,20) |
| InChIKey | VUHOPDRZXSHGBY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|