C10H13F4N5 — CID 106294620
1-ethyl-3-methyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazol-5-amine (PubChem CID 106294620) has the molecular formula C10H13F4N5 and a molecular weight of 279.24 g/mol. Its IUPAC name is 1-ethyl-3-methyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazol-5-amine.
| Compound Name | 1-ethyl-3-methyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazol-5-amine |
|---|---|
| PubChem CID | 106294620 |
| Molecular Formula | C10H13F4N5 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-ethyl-3-methyl-6-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-d]pyrazol-5-amine |
| SMILES | CCn1nc(C)c2nc(N)n(CC(F)(F)C(F)F)c21 |
| InChI | InChI=1S/C10H13F4N5/c1-3-19-7-6(5(2)17-19)16-9(15)18(7)4-10(13,14)8(11)12/h8H,3-4H2,1-2H3,(H2,15,16) |
| InChIKey | NPMDPLSJXINJAJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|