C10H13F4N3O2 — CID 106294832
methyl 5-amino-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)imidazole-4-carboxylate (PubChem CID 106294832) has the molecular formula C10H13F4N3O2 and a molecular weight of 283.22 g/mol. Its IUPAC name is methyl 5-amino-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)imidazole-4-carboxylate.
| Compound Name | methyl 5-amino-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 106294832 |
| Molecular Formula | C10H13F4N3O2 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | methyl 5-amino-2-ethyl-1-(2,2,3,3-tetrafluoropropyl)imidazole-4-carboxylate |
| SMILES | CCc1nc(C(=O)OC)c(N)n1CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H13F4N3O2/c1-3-5-16-6(8(18)19-2)7(15)17(5)4-10(13,14)9(11)12/h9H,3-4,15H2,1-2H3 |
| InChIKey | LJNZFNKSXCCMRY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|