C10H11F4N3O3S — CID 106294835
2-[2-(2,2,3,3-tetrafluoropropylcarbamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 106294835) has the molecular formula C10H11F4N3O3S and a molecular weight of 329.28 g/mol. Its IUPAC name is 2-[2-(2,2,3,3-tetrafluoropropylcarbamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-(2,2,3,3-tetrafluoropropylcarbamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106294835 |
| Molecular Formula | C10H11F4N3O3S |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-[2-(2,2,3,3-tetrafluoropropylcarbamoylamino)ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(NCCc1nc(C(=O)O)cs1)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H11F4N3O3S/c11-8(12)10(13,14)4-16-9(20)15-2-1-6-17-5(3-21-6)7(18)19/h3,8H,1-2,4H2,(H,18,19)(H2,15,16,20) |
| InChIKey | JVJOKHZFEXLZTE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|