C14H20F4N2 — CID 106294841
2,6,6-trimethyl-1-(2,2,3,3-tetrafluoropropyl)-5,7-dihydro-4H-indol-4-amine (PubChem CID 106294841) has the molecular formula C14H20F4N2 and a molecular weight of 292.32 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-(2,2,3,3-tetrafluoropropyl)-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 2,6,6-trimethyl-1-(2,2,3,3-tetrafluoropropyl)-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 106294841 |
| Molecular Formula | C14H20F4N2 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2,6,6-trimethyl-1-(2,2,3,3-tetrafluoropropyl)-5,7-dihydro-4H-indol-4-amine |
| SMILES | Cc1cc2c(n1CC(F)(F)C(F)F)CC(C)(C)CC2N |
| InChI | InChI=1S/C14H20F4N2/c1-8-4-9-10(19)5-13(2,3)6-11(9)20(8)7-14(17,18)12(15)16/h4,10,12H,5-7,19H2,1-3H3 |
| InChIKey | ZSQIMVMAMWTEPN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|