C8H12F4N2O4 — CID 106294947
(2S)-2-hydroxy-4-(2,2,3,3-tetrafluoropropylcarbamoylamino)butanoic acid (PubChem CID 106294947) has the molecular formula C8H12F4N2O4 and a molecular weight of 276.19 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-(2,2,3,3-tetrafluoropropylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-(2,2,3,3-tetrafluoropropylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 106294947 |
| Molecular Formula | C8H12F4N2O4 |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (2S)-2-hydroxy-4-(2,2,3,3-tetrafluoropropylcarbamoylamino)butanoic acid |
| SMILES | O=C(NCC[C@H](O)C(=O)O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H12F4N2O4/c9-6(10)8(11,12)3-14-7(18)13-2-1-4(15)5(16)17/h4,6,15H,1-3H2,(H,16,17)(H2,13,14,18)/t4-/m0/s1 |
| InChIKey | DQJMVAHXLWJCHO-BYPYZUCNSA-N |
| XLogP | 0.02 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|