C13H13ClF4N2 — CID 106294982
2-(1-chloroethyl)-5-methyl-1-(2,2,3,3-tetrafluoropropyl)benzimidazole (PubChem CID 106294982) has the molecular formula C13H13ClF4N2 and a molecular weight of 308.71 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-methyl-1-(2,2,3,3-tetrafluoropropyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-methyl-1-(2,2,3,3-tetrafluoropropyl)benzimidazole |
|---|---|
| PubChem CID | 106294982 |
| Molecular Formula | C13H13ClF4N2 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-(1-chloroethyl)-5-methyl-1-(2,2,3,3-tetrafluoropropyl)benzimidazole |
| SMILES | Cc1ccc2c(c1)nc(C(C)Cl)n2CC(F)(F)C(F)F |
| InChI | InChI=1S/C13H13ClF4N2/c1-7-3-4-10-9(5-7)19-11(8(2)14)20(10)6-13(17,18)12(15)16/h3-5,8,12H,6H2,1-2H3 |
| InChIKey | RGNKUEZCWZWWAA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|