C10H14F4N2O4 — CID 106295084
4-(2,2,3,3-tetrafluoropropylcarbamoylamino)oxane-4-carboxylic acid (PubChem CID 106295084) has the molecular formula C10H14F4N2O4 and a molecular weight of 302.22 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropylcarbamoylamino)oxane-4-carboxylic acid.
| Compound Name | 4-(2,2,3,3-tetrafluoropropylcarbamoylamino)oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 106295084 |
| Molecular Formula | C10H14F4N2O4 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropylcarbamoylamino)oxane-4-carboxylic acid |
| SMILES | O=C(NCC(F)(F)C(F)F)NC1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C10H14F4N2O4/c11-6(12)10(13,14)5-15-8(19)16-9(7(17)18)1-3-20-4-2-9/h6H,1-5H2,(H,17,18)(H2,15,16,19) |
| InChIKey | XGFPMQLBRZFWLS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|