C12H14F4N2O3 — CID 106295254
2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]propanoic acid (PubChem CID 106295254) has the molecular formula C12H14F4N2O3 and a molecular weight of 310.25 g/mol. Its IUPAC name is 2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]propanoic acid.
| Compound Name | 2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 106295254 |
| Molecular Formula | C12H14F4N2O3 |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]propanoic acid |
| SMILES | Cc1nc(=O)n(CC(F)(F)C(F)F)c(C)c1C(C)C(=O)O |
| InChI | InChI=1S/C12H14F4N2O3/c1-5(9(19)20)8-6(2)17-11(21)18(7(8)3)4-12(15,16)10(13)14/h5,10H,4H2,1-3H3,(H,19,20) |
| InChIKey | DWNRREQPIXZWQW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|