C11H12F4N2O3 — CID 106295256
2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]acetic acid (PubChem CID 106295256) has the molecular formula C11H12F4N2O3 and a molecular weight of 296.22 g/mol. Its IUPAC name is 2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 106295256 |
| Molecular Formula | C11H12F4N2O3 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-[4,6-dimethyl-2-oxo-1-(2,2,3,3-tetrafluoropropyl)pyrimidin-5-yl]acetic acid |
| SMILES | Cc1nc(=O)n(CC(F)(F)C(F)F)c(C)c1CC(=O)O |
| InChI | InChI=1S/C11H12F4N2O3/c1-5-7(3-8(18)19)6(2)17(10(20)16-5)4-11(14,15)9(12)13/h9H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | FIKASIVXGFRPIX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|