C12H21F4N3O2 — CID 106295276
2-(N'-hydroxycarbamimidoyl)-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide (PubChem CID 106295276) has the molecular formula C12H21F4N3O2 and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide |
|---|---|
| PubChem CID | 106295276 |
| Molecular Formula | C12H21F4N3O2 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-2-propyl-N-(2,2,3,3-tetrafluoropropyl)pentanamide |
| SMILES | CCCC(CCC)(C(=O)NCC(F)(F)C(F)F)C(N)=NO |
| InChI | InChI=1S/C12H21F4N3O2/c1-3-5-11(6-4-2,9(17)19-21)10(20)18-7-12(15,16)8(13)14/h8,21H,3-7H2,1-2H3,(H2,17,19)(H,18,20) |
| InChIKey | OIWARKJLCWDQIO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|