C4H6BrF4NO2S — CID 106295324
1-bromo-N-(2,2,3,3-tetrafluoropropyl)methanesulfonamide (PubChem CID 106295324) has the molecular formula C4H6BrF4NO2S and a molecular weight of 288.06 g/mol. Its IUPAC name is 1-bromo-N-(2,2,3,3-tetrafluoropropyl)methanesulfonamide.
| Compound Name | 1-bromo-N-(2,2,3,3-tetrafluoropropyl)methanesulfonamide |
|---|---|
| PubChem CID | 106295324 |
| Molecular Formula | C4H6BrF4NO2S |
| Molecular Weight | 288.06 g/mol |
| Exact Mass | 286.92 |
| IUPAC Name | 1-bromo-N-(2,2,3,3-tetrafluoropropyl)methanesulfonamide |
| SMILES | O=S(=O)(CBr)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C4H6BrF4NO2S/c5-2-13(11,12)10-1-4(8,9)3(6)7/h3,10H,1-2H2 |
| InChIKey | NBLJDFMPIJSZSE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.06 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|