C7H6F4N2O2S — CID 106295399
5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 106295399) has the molecular formula C7H6F4N2O2S and a molecular weight of 258.20 g/mol. Its IUPAC name is 5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106295399 |
| Molecular Formula | C7H6F4N2O2S |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 5-(2,2,3,3-tetrafluoropropylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H6F4N2O2S/c8-6(9)7(10,11)1-12-4-3(5(14)15)13-2-16-4/h2,6,12H,1H2,(H,14,15) |
| InChIKey | AUJGJVDRGPUQMW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|