C10H10ClF4N3O — CID 106295406
5-amino-3-chloro-2-(2,2,3,3-tetrafluoropropylamino)benzamide (PubChem CID 106295406) has the molecular formula C10H10ClF4N3O and a molecular weight of 299.66 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,2,3,3-tetrafluoropropylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(2,2,3,3-tetrafluoropropylamino)benzamide |
|---|---|
| PubChem CID | 106295406 |
| Molecular Formula | C10H10ClF4N3O |
| Molecular Weight | 299.66 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 5-amino-3-chloro-2-(2,2,3,3-tetrafluoropropylamino)benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H10ClF4N3O/c11-6-2-4(16)1-5(8(17)19)7(6)18-3-10(14,15)9(12)13/h1-2,9,18H,3,16H2,(H2,17,19) |
| InChIKey | TXENZXWKVFHRCY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.66 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|