C10H9F5N2O2 — CID 106295430
2-amino-4-fluoro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid (PubChem CID 106295430) has the molecular formula C10H9F5N2O2 and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid.
| Compound Name | 2-amino-4-fluoro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid |
|---|---|
| PubChem CID | 106295430 |
| Molecular Formula | C10H9F5N2O2 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-amino-4-fluoro-5-(2,2,3,3-tetrafluoropropylamino)benzoic acid |
| SMILES | Nc1cc(F)c(NCC(F)(F)C(F)F)cc1C(=O)O |
| InChI | InChI=1S/C10H9F5N2O2/c11-5-2-6(16)4(8(18)19)1-7(5)17-3-10(14,15)9(12)13/h1-2,9,17H,3,16H2,(H,18,19) |
| InChIKey | VNLBECRZAGPPFD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|