C9H10F4N2OS — CID 106295438
1-[3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazol-4-yl]ethanone (PubChem CID 106295438) has the molecular formula C9H10F4N2OS and a molecular weight of 270.25 g/mol. Its IUPAC name is 1-[3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazol-4-yl]ethanone.
| Compound Name | 1-[3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 106295438 |
| Molecular Formula | C9H10F4N2OS |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1-[3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1c(C)nsc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H10F4N2OS/c1-4-6(5(2)16)7(17-15-4)14-3-9(12,13)8(10)11/h8,14H,3H2,1-2H3 |
| InChIKey | RKLHDYHVDRZFQE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|