C8H8F4N2O2S — CID 106295440
3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylic acid (PubChem CID 106295440) has the molecular formula C8H8F4N2O2S and a molecular weight of 272.22 g/mol. Its IUPAC name is 3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylic acid.
| Compound Name | 3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106295440 |
| Molecular Formula | C8H8F4N2O2S |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3-methyl-5-(2,2,3,3-tetrafluoropropylamino)-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(NCC(F)(F)C(F)F)c1C(=O)O |
| InChI | InChI=1S/C8H8F4N2O2S/c1-3-4(6(15)16)5(17-14-3)13-2-8(11,12)7(9)10/h7,13H,2H2,1H3,(H,15,16) |
| InChIKey | ZXVYVOBGVLOHCT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|