C9H18F4N2O2S — CID 106295870
1-(propan-2-ylamino)-N-(2,2,3,3-tetrafluoropropyl)propane-2-sulfonamide (PubChem CID 106295870) has the molecular formula C9H18F4N2O2S and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-(propan-2-ylamino)-N-(2,2,3,3-tetrafluoropropyl)propane-2-sulfonamide.
| Compound Name | 1-(propan-2-ylamino)-N-(2,2,3,3-tetrafluoropropyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106295870 |
| Molecular Formula | C9H18F4N2O2S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(propan-2-ylamino)-N-(2,2,3,3-tetrafluoropropyl)propane-2-sulfonamide |
| SMILES | CC(C)NCC(C)S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H18F4N2O2S/c1-6(2)14-4-7(3)18(16,17)15-5-9(12,13)8(10)11/h6-8,14-15H,4-5H2,1-3H3 |
| InChIKey | NJZSFTQQODPXOY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|