C5H7F4N5 — CID 106296010
3-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 106296010) has the molecular formula C5H7F4N5 and a molecular weight of 213.14 g/mol. Its IUPAC name is 3-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 106296010 |
| Molecular Formula | C5H7F4N5 |
| Molecular Weight | 213.14 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-N-(2,2,3,3-tetrafluoropropyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(NCC(F)(F)C(F)F)n[nH]1 |
| InChI | InChI=1S/C5H7F4N5/c6-2(7)5(8,9)1-11-4-12-3(10)13-14-4/h2H,1H2,(H4,10,11,12,13,14) |
| InChIKey | JPFDXCCGFSMILW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|