C10H10F4N2O2S — CID 106296034
2-(2,2,3,3-tetrafluoropropylamino)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid (PubChem CID 106296034) has the molecular formula C10H10F4N2O2S and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropylamino)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid.
| Compound Name | 2-(2,2,3,3-tetrafluoropropylamino)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106296034 |
| Molecular Formula | C10H10F4N2O2S |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropylamino)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid |
| SMILES | O=C(O)C1CCc2sc(NCC(F)(F)C(F)F)nc21 |
| InChI | InChI=1S/C10H10F4N2O2S/c11-8(12)10(13,14)3-15-9-16-6-4(7(17)18)1-2-5(6)19-9/h4,8H,1-3H2,(H,15,16)(H,17,18) |
| InChIKey | MZWGVJBUXKZLEP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|