C8H16F4N4O — CID 106296460
1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,3,3-tetrafluoropropyl)guanidine (PubChem CID 106296460) has the molecular formula C8H16F4N4O and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,3,3-tetrafluoropropyl)guanidine.
| Compound Name | 1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,3,3-tetrafluoropropyl)guanidine |
|---|---|
| PubChem CID | 106296460 |
| Molecular Formula | C8H16F4N4O |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-amino-3-(1-methoxypropan-2-yl)-2-(2,2,3,3-tetrafluoropropyl)guanidine |
| SMILES | COCC(C)N/C(=N/CC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C8H16F4N4O/c1-5(3-17-2)15-7(16-13)14-4-8(11,12)6(9)10/h5-6H,3-4,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | TVFCKCRKUYAFKA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|