C9H14F4N4O2 — CID 106296572
5-[(2-methoxyethylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106296572) has the molecular formula C9H14F4N4O2 and a molecular weight of 286.23 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106296572 |
| Molecular Formula | C9H14F4N4O2 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | COCCNCc1nnc(NCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C9H14F4N4O2/c1-18-3-2-14-4-6-16-17-8(19-6)15-5-9(12,13)7(10)11/h7,14H,2-5H2,1H3,(H,15,17) |
| InChIKey | SINNKICFJTTWQB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|