C10H16F4N4O — CID 106296576
5-[(2-methylpropylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106296576) has the molecular formula C10H16F4N4O and a molecular weight of 284.26 g/mol. Its IUPAC name is 5-[(2-methylpropylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2-methylpropylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106296576 |
| Molecular Formula | C10H16F4N4O |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-[(2-methylpropylamino)methyl]-N-(2,2,3,3-tetrafluoropropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(C)CNCc1nnc(NCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C10H16F4N4O/c1-6(2)3-15-4-7-17-18-9(19-7)16-5-10(13,14)8(11)12/h6,8,15H,3-5H2,1-2H3,(H,16,18) |
| InChIKey | GUCNOZMMQRAFCO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|