C15H19NO5 — CID 106296960
2-[2-[[4-(hydroxymethyl)oxan-4-yl]amino]-2-oxoethyl]benzoic acid (PubChem CID 106296960) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[2-[[4-(hydroxymethyl)oxan-4-yl]amino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[[4-(hydroxymethyl)oxan-4-yl]amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 106296960 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-[2-[[4-(hydroxymethyl)oxan-4-yl]amino]-2-oxoethyl]benzoic acid |
| SMILES | O=C(Cc1ccccc1C(=O)O)NC1(CO)CCOCC1 |
| InChI | InChI=1S/C15H19NO5/c17-10-15(5-7-21-8-6-15)16-13(18)9-11-3-1-2-4-12(11)14(19)20/h1-4,17H,5-10H2,(H,16,18)(H,19,20) |
| InChIKey | QDGGBHHYBBNRNM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |