C12H17NO5 — CID 106297075
5-[[[4-(hydroxymethyl)oxan-4-yl]amino]methyl]furan-2-carboxylic acid (PubChem CID 106297075) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 5-[[[4-(hydroxymethyl)oxan-4-yl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[4-(hydroxymethyl)oxan-4-yl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106297075 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-[[[4-(hydroxymethyl)oxan-4-yl]amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNC2(CO)CCOCC2)o1 |
| InChI | InChI=1S/C12H17NO5/c14-8-12(3-5-17-6-4-12)13-7-9-1-2-10(18-9)11(15)16/h1-2,13-14H,3-8H2,(H,15,16) |
| InChIKey | HFQVIGHSKFYLSC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |