C10H18N2O2 — CID 106297496
[4-(3,4-dihydro-2H-pyrrol-5-ylamino)oxan-4-yl]methanol (PubChem CID 106297496) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is [4-(3,4-dihydro-2H-pyrrol-5-ylamino)oxan-4-yl]methanol.
| Compound Name | [4-(3,4-dihydro-2H-pyrrol-5-ylamino)oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106297496 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [4-(3,4-dihydro-2H-pyrrol-5-ylamino)oxan-4-yl]methanol |
| SMILES | OCC1(NC2=NCCC2)CCOCC1 |
| InChI | InChI=1S/C10H18N2O2/c13-8-10(3-6-14-7-4-10)12-9-2-1-5-11-9/h13H,1-8H2,(H,11,12) |
| InChIKey | MSFXMXZCUYGKSL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |