C14H18N2OS2 — CID 106297593
N-(3-methylsulfanylphenyl)-8-oxa-3-thia-1-azaspiro[4.5]dec-1-en-2-amine (PubChem CID 106297593) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-8-oxa-3-thia-1-azaspiro[4.5]dec-1-en-2-amine.
| Compound Name | N-(3-methylsulfanylphenyl)-8-oxa-3-thia-1-azaspiro[4.5]dec-1-en-2-amine |
|---|---|
| PubChem CID | 106297593 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-8-oxa-3-thia-1-azaspiro[4.5]dec-1-en-2-amine |
| SMILES | CSc1cccc(NC2=NC3(CCOCC3)CS2)c1 |
| InChI | InChI=1S/C14H18N2OS2/c1-18-12-4-2-3-11(9-12)15-13-16-14(10-19-13)5-7-17-8-6-14/h2-4,9H,5-8,10H2,1H3,(H,15,16) |
| InChIKey | KHHJVTKHRSEYHF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |