C13H15F2NO3 — CID 106298371
2,6-difluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzamide (PubChem CID 106298371) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 106298371 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2,6-difluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzamide |
| SMILES | O=C(NC1(CO)CCOCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H15F2NO3/c14-9-2-1-3-10(15)11(9)12(18)16-13(8-17)4-6-19-7-5-13/h1-3,17H,4-8H2,(H,16,18) |
| InChIKey | VSVSQAMEQDXGCH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |