C12H15BrFNO4S — CID 106298849
4-bromo-3-fluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide (PubChem CID 106298849) has the molecular formula C12H15BrFNO4S and a molecular weight of 368.22 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide.
| Compound Name | 4-bromo-3-fluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 106298849 |
| Molecular Formula | C12H15BrFNO4S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 4-bromo-3-fluoro-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1(CO)CCOCC1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H15BrFNO4S/c13-10-2-1-9(7-11(10)14)20(17,18)15-12(8-16)3-5-19-6-4-12/h1-2,7,15-16H,3-6,8H2 |
| InChIKey | DYFTVOJFMRQVAN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |