C56H48Cl4N10O2 — CID 10629888
[4-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonane-1-carbonyl]phenyl]-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]methanone (PubChem CID 10629888) has the molecular formula C56H48Cl4N10O2 and a molecular weight of 1034.88 g/mol. Its IUPAC name is [4-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonane-1-carbonyl]phenyl]-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]methanone.
| Compound Name | [4-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonane-1-carbonyl]phenyl]-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]methanone |
|---|---|
| PubChem CID | 10629888 |
| Molecular Formula | C56H48Cl4N10O2 |
| Molecular Weight | 1034.88 g/mol |
| Exact Mass | 1032.27 |
| IUPAC Name | [4-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonane-1-carbonyl]phenyl]-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]methanone |
| SMILES | O=C(c1ccc(C(=O)N2CCN(c3ccnc4cc(Cl)ccc34)CCN(c3ccnc4cc(Cl)ccc34)CC2)cc1)N1CCN(c2ccnc3cc(Cl)ccc23)CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C56H48Cl4N10O2/c57-39-5-9-43-47(33-39)61-17-13-51(43)65-21-22-66(52-14-18-62-48-34-40(58)6-10-44(48)52)26-30-69(29-25-65)55(71)37-1-2-38(4-3-37)56(72)70-31-27-67(53-15-19-63-49-35-41(59)7-11-45(49)53)23-24-68(28-32-70)54-16-20-64-50-36-42(60)8-12-46(50)54/h1-20,33-36H,21-32H2 |
| InChIKey | QJNRLOJJRGZTPL-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 105.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1034.88 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |