C14H21ClN2O3 — CID 106299633
4-(chloromethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]oxan-4-amine (PubChem CID 106299633) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]oxan-4-amine.
| Compound Name | 4-(chloromethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 106299633 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-(chloromethyl)-N-[(3,4-dimethoxy-2-pyridinyl)methyl]oxan-4-amine |
| SMILES | COc1ccnc(CNC2(CCl)CCOCC2)c1OC |
| InChI | InChI=1S/C14H21ClN2O3/c1-18-12-3-6-16-11(13(12)19-2)9-17-14(10-15)4-7-20-8-5-14/h3,6,17H,4-5,7-10H2,1-2H3 |
| InChIKey | QGQBHEKMRJYSPX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|