C11H14Cl2N2O — CID 106300071
3-chloro-N-[4-(chloromethyl)oxan-4-yl]pyridin-4-amine (PubChem CID 106300071) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is 3-chloro-N-[4-(chloromethyl)oxan-4-yl]pyridin-4-amine.
| Compound Name | 3-chloro-N-[4-(chloromethyl)oxan-4-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 106300071 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-chloro-N-[4-(chloromethyl)oxan-4-yl]pyridin-4-amine |
| SMILES | ClCC1(Nc2ccncc2Cl)CCOCC1 |
| InChI | InChI=1S/C11H14Cl2N2O/c12-8-11(2-5-16-6-3-11)15-10-1-4-14-7-9(10)13/h1,4,7H,2-3,5-6,8H2,(H,14,15) |
| InChIKey | OWURCTCLXTXOMR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|