C15H24N2O3 — CID 106301472
2-[4-(aminomethyl)oxan-4-yl]-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 106301472) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[4-(aminomethyl)oxan-4-yl]-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 2-[4-(aminomethyl)oxan-4-yl]-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 106301472 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-[4-(aminomethyl)oxan-4-yl]-5-ethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | CCC1CC2C(=O)N(C3(CN)CCOCC3)C(=O)C2C1 |
| InChI | InChI=1S/C15H24N2O3/c1-2-10-7-11-12(8-10)14(19)17(13(11)18)15(9-16)3-5-20-6-4-15/h10-12H,2-9,16H2,1H3 |
| InChIKey | GOMKIUVDPHBWSC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|