C12H14N6S — CID 106301770
3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 106301770) has the molecular formula C12H14N6S and a molecular weight of 274.35 g/mol. Its IUPAC name is 3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 106301770 |
| Molecular Formula | C12H14N6S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | CCn1cnnc1Cn1c(=S)[nH]c2c(C)ccnc21 |
| InChI | InChI=1S/C12H14N6S/c1-3-17-7-14-16-9(17)6-18-11-10(15-12(18)19)8(2)4-5-13-11/h4-5,7H,3,6H2,1-2H3,(H,15,19) |
| InChIKey | VGVSXZYMIRXZAD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|