C14H16N4O2S — CID 106304018
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide (PubChem CID 106304018) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106304018 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
| SMILES | CCn1cnnc1CNC(=O)c1sccc1C#CCCO |
| InChI | InChI=1S/C14H16N4O2S/c1-2-18-10-16-17-12(18)9-15-14(20)13-11(6-8-21-13)5-3-4-7-19/h6,8,10,19H,2,4,7,9H2,1H3,(H,15,20) |
| InChIKey | VCBXPXVVHHCWEB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|