C10H15N7 — CID 106304580
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinylpyridin-2-amine (PubChem CID 106304580) has the molecular formula C10H15N7 and a molecular weight of 233.28 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinylpyridin-2-amine.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 106304580 |
| Molecular Formula | C10H15N7 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinylpyridin-2-amine |
| SMILES | CCn1cnnc1CNc1cccc(NN)n1 |
| InChI | InChI=1S/C10H15N7/c1-2-17-7-13-16-10(17)6-12-8-4-3-5-9(14-8)15-11/h3-5,7H,2,6,11H2,1H3,(H2,12,14,15) |
| InChIKey | ACLZDJGWFOJJLZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|