C6H6O2 — CID 10630461
3,4,5,6-tetradeuteriobenzene-1,2-diol (PubChem CID 10630461) has the molecular formula C6H6O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 3,4,5,6-tetradeuteriobenzene-1,2-diol.
| Compound Name | 3,4,5,6-tetradeuteriobenzene-1,2-diol |
|---|---|
| PubChem CID | 10630461 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | 3,4,5,6-tetradeuteriobenzene-1,2-diol |
| SMILES | [2H]c1c([2H])c([2H])c(O)c(O)c1[2H] |
| InChI | InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H/i1D,2D,3D,4D |
| InChIKey | YCIMNLLNPGFGHC-RHQRLBAQSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|