C10H13F3N8 — CID 106304624
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 106304624) has the molecular formula C10H13F3N8 and a molecular weight of 302.26 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106304624 |
| Molecular Formula | C10H13F3N8 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-hydrazinyl-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCn1cnnc1CNc1cc(NN)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N8/c1-2-21-5-16-20-8(21)4-15-6-3-7(19-14)18-9(17-6)10(11,12)13/h3,5H,2,4,14H2,1H3,(H2,15,17,18,19) |
| InChIKey | CZGJHFLYFRVRAL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|